C25H23NO4 — CID 22813489
naphthalen-2-yl (2S)-2-(2,7-dioxoazepan-1-yl)-3-phenylpropanoate (PubChem CID 22813489) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is naphthalen-2-yl (2S)-2-(2,7-dioxoazepan-1-yl)-3-phenylpropanoate.
| Compound Name | naphthalen-2-yl (2S)-2-(2,7-dioxoazepan-1-yl)-3-phenylpropanoate |
|---|---|
| PubChem CID | 22813489 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | naphthalen-2-yl (2S)-2-(2,7-dioxoazepan-1-yl)-3-phenylpropanoate |
| SMILES | O=C(Oc1ccc2ccccc2c1)[C@H](Cc1ccccc1)N1C(=O)CCCCC1=O |
| InChI | InChI=1S/C25H23NO4/c27-23-12-6-7-13-24(28)26(23)22(16-18-8-2-1-3-9-18)25(29)30-21-15-14-19-10-4-5-11-20(19)17-21/h1-5,8-11,14-15,17,22H,6-7,12-13,16H2/t22-/m0/s1 |
| InChIKey | JZQPZHCNMRCBJB-QFIPXVFZSA-N |
| XLogP | 4.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|