C13H16N2O5 — CID 160827059
(2S)-2-amino-3-phenylpropanoic acid;1-hydroxypyrrolidine-2,5-dione (PubChem CID 160827059) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;1-hydroxypyrrolidine-2,5-dione.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;1-hydroxypyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 160827059 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;1-hydroxypyrrolidine-2,5-dione |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C9H11NO2.C4H5NO3/c10-8(9(11)12)6-7-4-2-1-3-5-7;6-3-1-2-4(7)5(3)8/h1-5,8H,6,10H2,(H,11,12);8H,1-2H2/t8-;/m0./s1 |
| InChIKey | SGHVWLQFBVRRNK-QRPNPIFTSA-N |
| XLogP | 0.17 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|