About (Z)-4-bromo-3-methylbut-2-enoic acid;ethene
(Z)-4-bromo-3-methylbut-2-enoic acid;ethene (PubChem CID 158470113) has the molecular formula C7H11BrO2
and a molecular weight of 207.07 g/mol. Its IUPAC name is (Z)-4-bromo-3-methylbut-2-enoic acid;ethene.
Molecular Properties
| Compound Name | (Z)-4-bromo-3-methylbut-2-enoic acid;ethene |
| PubChem CID | 158470113 |
| Molecular Formula | C7H11BrO2 |
| Molecular Weight | 207.07 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | (Z)-4-bromo-3-methylbut-2-enoic acid;ethene |
| SMILES | C/C(=C/C(=O)O)CBr.C=C |
| InChI | InChI=1S/C5H7BrO2.C2H4/c1-4(3-6)2-5(7)8;1-2/h2H,3H2,1H3,(H,7,8);1-2H2/b4-2-; |
| InChIKey | HGGCAFKYCXLSIR-MKHFZPSSSA-N |
| XLogP | 2.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.07 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-bromo-3-methylbut-2-enoic acid;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-bromo-3-methylbut-2-enoic acid;ethene?
The IUPAC name of (Z)-4-bromo-3-methylbut-2-enoic acid;ethene (CID 158470113) is (Z)-4-bromo-3-methylbut-2-enoic acid;ethene.
What is the SMILES notation for (Z)-4-bromo-3-methylbut-2-enoic acid;ethene?
The canonical SMILES for (Z)-4-bromo-3-methylbut-2-enoic acid;ethene is C/C(=C/C(=O)O)CBr.C=C.
What is the InChIKey of (Z)-4-bromo-3-methylbut-2-enoic acid;ethene?
The InChIKey is HGGCAFKYCXLSIR-MKHFZPSSSA-N. The full InChI is InChI=1S/C5H7BrO2.C2H4/c1-4(3-6)2-5(7)8;1-2/h2H,3H2,1H3,(H,7,8);1-2H2/b4-2-;.
What are the key properties of (Z)-4-bromo-3-methylbut-2-enoic acid;ethene?
(Z)-4-bromo-3-methylbut-2-enoic acid;ethene has a molecular weight of 207.07 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-bromo-3-methylbut-2-enoic acid;ethene is sourced from PubChem (CID 158470113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).