About bis((E)-2-methylbut-2-enedioic acid);zirconium
bis((E)-2-methylbut-2-enedioic acid);zirconium (PubChem CID 146019810) has the molecular formula C10H12O8Zr
and a molecular weight of 351.42 g/mol. Its IUPAC name is bis((E)-2-methylbut-2-enedioic acid);zirconium.
Molecular Properties
| Compound Name | bis((E)-2-methylbut-2-enedioic acid);zirconium |
| PubChem CID | 146019810 |
| Molecular Formula | C10H12O8Zr |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | bis((E)-2-methylbut-2-enedioic acid);zirconium |
| SMILES | C/C(=C/C(=O)O)C(=O)O.C/C(=C/C(=O)O)C(=O)O.[Zr] |
| InChI | InChI=1S/2C5H6O4.Zr/c2*1-3(5(8)9)2-4(6)7;/h2*2H,1H3,(H,6,7)(H,8,9);/b2*3-2-; |
| InChIKey | SAKSAYHRWHSASA-OZWADYBTSA-N |
| XLogP | 0.20 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((E)-2-methylbut-2-enedioic acid);zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((E)-2-methylbut-2-enedioic acid);zirconium?
The IUPAC name of bis((E)-2-methylbut-2-enedioic acid);zirconium (CID 146019810) is bis((E)-2-methylbut-2-enedioic acid);zirconium.
What is the SMILES notation for bis((E)-2-methylbut-2-enedioic acid);zirconium?
The canonical SMILES for bis((E)-2-methylbut-2-enedioic acid);zirconium is C/C(=C/C(=O)O)C(=O)O.C/C(=C/C(=O)O)C(=O)O.[Zr].
What is the InChIKey of bis((E)-2-methylbut-2-enedioic acid);zirconium?
The InChIKey is SAKSAYHRWHSASA-OZWADYBTSA-N. The full InChI is InChI=1S/2C5H6O4.Zr/c2*1-3(5(8)9)2-4(6)7;/h2*2H,1H3,(H,6,7)(H,8,9);/b2*3-2-;.
What are the key properties of bis((E)-2-methylbut-2-enedioic acid);zirconium?
bis((E)-2-methylbut-2-enedioic acid);zirconium has a molecular weight of 351.42 g/mol, XLogP of 0.20, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((E)-2-methylbut-2-enedioic acid);zirconium is sourced from PubChem (CID 146019810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).