di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid

C11H20O4Sn — CID 159532184

IUPACdi(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid
SMILESC/C(=C/C(=O)O)C(=O)O.CC(C)[Sn]C(C)C
InChIInChI=1S/C5H6O4.2C3H7.Sn/c1-3(5(8)9)2-4(6)7;2*1-3-2;/h2H,1H3,(H,6,7)(H,8,9);2*3H,1-2H3;/b3-2-;;;
InChIKeyMDDGGAUAPFBXNI-GDNGEXCGSA-N
MW334.99 g/mol
LogP2.45
Rot. Bonds4

About di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid

di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid (PubChem CID 159532184) has the molecular formula C11H20O4Sn and a molecular weight of 334.99 g/mol. Its IUPAC name is di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid.

Molecular Properties

Compound Namedi(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid
PubChem CID159532184
Molecular FormulaC11H20O4Sn
Molecular Weight334.99 g/mol
Exact Mass336.04
IUPAC Namedi(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid
SMILESC/C(=C/C(=O)O)C(=O)O.CC(C)[Sn]C(C)C
InChIInChI=1S/C5H6O4.2C3H7.Sn/c1-3(5(8)9)2-4(6)7;2*1-3-2;/h2H,1H3,(H,6,7)(H,8,9);2*3H,1-2H3;/b3-2-;;;
InChIKeyMDDGGAUAPFBXNI-GDNGEXCGSA-N
XLogP2.45
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.99
LogP ≤ 52.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid?
The IUPAC name of di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid (CID 159532184) is di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid.
What is the SMILES notation for di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid?
The canonical SMILES for di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid is C/C(=C/C(=O)O)C(=O)O.CC(C)[Sn]C(C)C.
What is the InChIKey of di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid?
The InChIKey is MDDGGAUAPFBXNI-GDNGEXCGSA-N. The full InChI is InChI=1S/C5H6O4.2C3H7.Sn/c1-3(5(8)9)2-4(6)7;2*1-3-2;/h2H,1H3,(H,6,7)(H,8,9);2*3H,1-2H3;/b3-2-;;;.
What are the key properties of di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid?
di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid has a molecular weight of 334.99 g/mol, XLogP of 2.45, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yl)tin;(Z)-2-methylbut-2-enedioic acid is sourced from PubChem (CID 159532184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).