3-methyl-4-phosphonobut-2-enoic acid

C5H9O5P — CID 54146523

IUPAC3-methyl-4-phosphonobut-2-enoic acid
SMILESCC(=CC(=O)O)CP(=O)(O)O
InChIInChI=1S/C5H9O5P/c1-4(2-5(6)7)3-11(8,9)10/h2H,3H2,1H3,(H,6,7)(H2,8,9,10)
InChIKeyOETMAOGOSNRWQN-UHFFFAOYSA-N
MW180.10 g/mol
LogP0.19
Rot. Bonds3

About 3-methyl-4-phosphonobut-2-enoic acid

3-methyl-4-phosphonobut-2-enoic acid (PubChem CID 54146523) has the molecular formula C5H9O5P and a molecular weight of 180.10 g/mol. Its IUPAC name is 3-methyl-4-phosphonobut-2-enoic acid.

Molecular Properties

Compound Name3-methyl-4-phosphonobut-2-enoic acid
PubChem CID54146523
Molecular FormulaC5H9O5P
Molecular Weight180.10 g/mol
Exact Mass180.02
IUPAC Name3-methyl-4-phosphonobut-2-enoic acid
SMILESCC(=CC(=O)O)CP(=O)(O)O
InChIInChI=1S/C5H9O5P/c1-4(2-5(6)7)3-11(8,9)10/h2H,3H2,1H3,(H,6,7)(H2,8,9,10)
InChIKeyOETMAOGOSNRWQN-UHFFFAOYSA-N
XLogP0.19
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.10
LogP ≤ 50.19
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 3-methyl-4-phosphonobut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-Phosphonobut-2-enoic acid
CID 53992138
3-Phosphonocrotonic acid
CID 88032600
3-(Fluoromethyl)-4-phosphonobut-2-enoic acid
CID 54030972
2-Fluoro-3-methyl-4-phosphonobut-2-enoic acid
CID 54574942
(Z)-2-fluoro-3-methyl-4-phosphonobut-2-enoic acid
CID 88435367
(E)-3-(fluoromethyl)-4-phosphonobut-2-enoic acid
CID 152766754
3-Phosphono-2-butenoicAcid
CID 122156654
(E)-4-phosphonobut-2-enoic acid
CID 10535051
(Z)-2-(phosphonomethyl)but-2-enoic acid
CID 13972183
(E)-2-(phosphonomethyl)but-2-enedioic acid
CID 14361008
(Z)-2-[[hydroxy(2-methylpropyl)phosphoryl]methyl]but-2-enoic acid
CID 15735596
CID 17996661
CID 17996661

Frequently Asked Questions

What is the IUPAC name of 3-methyl-4-phosphonobut-2-enoic acid?
The IUPAC name of 3-methyl-4-phosphonobut-2-enoic acid (CID 54146523) is 3-methyl-4-phosphonobut-2-enoic acid.
What is the SMILES notation for 3-methyl-4-phosphonobut-2-enoic acid?
The canonical SMILES for 3-methyl-4-phosphonobut-2-enoic acid is CC(=CC(=O)O)CP(=O)(O)O.
What is the InChIKey of 3-methyl-4-phosphonobut-2-enoic acid?
The InChIKey is OETMAOGOSNRWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9O5P/c1-4(2-5(6)7)3-11(8,9)10/h2H,3H2,1H3,(H,6,7)(H2,8,9,10).
What are the key properties of 3-methyl-4-phosphonobut-2-enoic acid?
3-methyl-4-phosphonobut-2-enoic acid has a molecular weight of 180.10 g/mol, XLogP of 0.19, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-phosphonobut-2-enoic acid is sourced from PubChem (CID 54146523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).