C13H20O4 — CID 135378820
(Z)-but-2-enedioic acid;2-methylbuta-1,3-diene;2-methylprop-1-ene (PubChem CID 135378820) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-methylbuta-1,3-diene;2-methylprop-1-ene.
| Compound Name | (Z)-but-2-enedioic acid;2-methylbuta-1,3-diene;2-methylprop-1-ene |
|---|---|
| PubChem CID | 135378820 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-methylbuta-1,3-diene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=CC(=C)C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C5H8.C4H4O4.C4H8/c1-4-5(2)3;5-3(6)1-2-4(7)8;1-4(2)3/h4H,1-2H2,3H3;1-2H,(H,5,6)(H,7,8);1H2,2-3H3/b;2-1-; |
| InChIKey | DLFYMHRAJQMUBQ-FJOGWHKWSA-N |
| XLogP | 3.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|