2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid

C10H21NO4 — CID 87094318

IUPAC2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid
SMILESC=C(C)C(=O)O.CCN(CCO)CCO
InChIInChI=1S/C6H15NO2.C4H6O2/c1-2-7(3-5-8)4-6-9;1-3(2)4(5)6/h8-9H,2-6H2,1H3;1H2,2H3,(H,5,6)
InChIKeyXUTFKAQTQRBNPI-UHFFFAOYSA-N
MW219.28 g/mol
LogP-0.06
Rot. Bonds6

About 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid

2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid (PubChem CID 87094318) has the molecular formula C10H21NO4 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid.

Molecular Properties

Compound Name2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid
PubChem CID87094318
Molecular FormulaC10H21NO4
Molecular Weight219.28 g/mol
Exact Mass219.15
IUPAC Name2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid
SMILESC=C(C)C(=O)O.CCN(CCO)CCO
InChIInChI=1S/C6H15NO2.C4H6O2/c1-2-7(3-5-8)4-6-9;1-3(2)4(5)6/h8-9H,2-6H2,1H3;1H2,2H3,(H,5,6)
InChIKeyXUTFKAQTQRBNPI-UHFFFAOYSA-N
XLogP-0.06
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.28
LogP ≤ 5-0.06
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid?
The IUPAC name of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid (CID 87094318) is 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid.
What is the SMILES notation for 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid?
The canonical SMILES for 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CCN(CCO)CCO.
What is the InChIKey of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid?
The InChIKey is XUTFKAQTQRBNPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2.C4H6O2/c1-2-7(3-5-8)4-6-9;1-3(2)4(5)6/h8-9H,2-6H2,1H3;1H2,2H3,(H,5,6).
What are the key properties of 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid?
2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid has a molecular weight of 219.28 g/mol, XLogP of -0.06, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(2-hydroxyethyl)amino]ethanol;2-methylprop-2-enoic acid is sourced from PubChem (CID 87094318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).