About (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene
(Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene (PubChem CID 174814897) has the molecular formula C12H23NO6
and a molecular weight of 277.32 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene |
| PubChem CID | 174814897 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene |
| SMILES | C=C(C)C.O=C(O)/C=C\C(=O)O.OCCNCCO |
| InChI | InChI=1S/C4H11NO2.C4H4O4.C4H8/c6-3-1-5-2-4-7;5-3(6)1-2-4(7)8;1-4(2)3/h5-7H,1-4H2;1-2H,(H,5,6)(H,7,8);1H2,2-3H3/b;2-1-; |
| InChIKey | QZPGGEWKOSZFMC-FJOGWHKWSA-N |
| XLogP | -0.15 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene?
The IUPAC name of (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene (CID 174814897) is (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene.
What is the SMILES notation for (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene?
The canonical SMILES for (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene is C=C(C)C.O=C(O)/C=C\C(=O)O.OCCNCCO.
What is the InChIKey of (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene?
The InChIKey is QZPGGEWKOSZFMC-FJOGWHKWSA-N. The full InChI is InChI=1S/C4H11NO2.C4H4O4.C4H8/c6-3-1-5-2-4-7;5-3(6)1-2-4(7)8;1-4(2)3/h5-7H,1-4H2;1-2H,(H,5,6)(H,7,8);1H2,2-3H3/b;2-1-;.
What are the key properties of (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene?
(Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene has a molecular weight of 277.32 g/mol, XLogP of -0.15, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;2-(2-hydroxyethylamino)ethanol;2-methylprop-1-ene is sourced from PubChem (CID 174814897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).