C11H29N5 — CID 143986937
N'-methyl-N'-[2-(2-piperazin-1-ylethylamino)ethyl]ethane-1,2-diamine;molecular hydrogen (PubChem CID 143986937) has the molecular formula C11H29N5 and a molecular weight of 231.39 g/mol. Its IUPAC name is N'-methyl-N'-[2-(2-piperazin-1-ylethylamino)ethyl]ethane-1,2-diamine;molecular hydrogen.
| Compound Name | N'-methyl-N'-[2-(2-piperazin-1-ylethylamino)ethyl]ethane-1,2-diamine;molecular hydrogen |
|---|---|
| PubChem CID | 143986937 |
| Molecular Formula | C11H29N5 |
| Molecular Weight | 231.39 g/mol |
| Exact Mass | 231.24 |
| IUPAC Name | N'-methyl-N'-[2-(2-piperazin-1-ylethylamino)ethyl]ethane-1,2-diamine;molecular hydrogen |
| SMILES | CN(CCN)CCNCCN1CCNCC1.[H][H] |
| InChI | InChI=1S/C11H27N5.H2/c1-15(7-2-12)8-3-13-4-9-16-10-5-14-6-11-16;/h13-14H,2-12H2,1H3;1H |
| InChIKey | YXRCDWQOOWUYJC-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 56.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.39 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|