C10H25N3S — CID 112666040
N',N'-dimethyl-N-[2-[methyl(2-methylsulfanylethyl)amino]ethyl]ethane-1,2-diamine (PubChem CID 112666040) has the molecular formula C10H25N3S and a molecular weight of 219.40 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-[methyl(2-methylsulfanylethyl)amino]ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-[methyl(2-methylsulfanylethyl)amino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 112666040 |
| Molecular Formula | C10H25N3S |
| Molecular Weight | 219.40 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | N',N'-dimethyl-N-[2-[methyl(2-methylsulfanylethyl)amino]ethyl]ethane-1,2-diamine |
| SMILES | CSCCN(C)CCNCCN(C)C |
| InChI | InChI=1S/C10H25N3S/c1-12(2)7-5-11-6-8-13(3)9-10-14-4/h11H,5-10H2,1-4H3 |
| InChIKey | NLZNTAOZIGWHFH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|