C11H26N2S — CID 112666080
N'-methyl-N-(3-methylbutyl)-N'-(2-methylsulfanylethyl)ethane-1,2-diamine (PubChem CID 112666080) has the molecular formula C11H26N2S and a molecular weight of 218.41 g/mol. Its IUPAC name is N'-methyl-N-(3-methylbutyl)-N'-(2-methylsulfanylethyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N-(3-methylbutyl)-N'-(2-methylsulfanylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 112666080 |
| Molecular Formula | C11H26N2S |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N'-methyl-N-(3-methylbutyl)-N'-(2-methylsulfanylethyl)ethane-1,2-diamine |
| SMILES | CSCCN(C)CCNCCC(C)C |
| InChI | InChI=1S/C11H26N2S/c1-11(2)5-6-12-7-8-13(3)9-10-14-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | YXDJJDVRNHUSNJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|