C10H24N2O — CID 63009569
3-N-(3-methoxypropyl)-1-N,3-N-dimethylbutane-1,3-diamine (PubChem CID 63009569) has the molecular formula C10H24N2O and a molecular weight of 188.31 g/mol. Its IUPAC name is 3-N-(3-methoxypropyl)-1-N,3-N-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-(3-methoxypropyl)-1-N,3-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 63009569 |
| Molecular Formula | C10H24N2O |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.19 |
| IUPAC Name | 3-N-(3-methoxypropyl)-1-N,3-N-dimethylbutane-1,3-diamine |
| SMILES | CNCCC(C)N(C)CCCOC |
| InChI | InChI=1S/C10H24N2O/c1-10(6-7-11-2)12(3)8-5-9-13-4/h10-11H,5-9H2,1-4H3 |
| InChIKey | DFWJPUGNAYGVDR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|