C11H26N2O — CID 63007950
4-N-(3-methoxypropyl)-1-N,4-N-dimethylpentane-1,4-diamine (PubChem CID 63007950) has the molecular formula C11H26N2O and a molecular weight of 202.34 g/mol. Its IUPAC name is 4-N-(3-methoxypropyl)-1-N,4-N-dimethylpentane-1,4-diamine.
| Compound Name | 4-N-(3-methoxypropyl)-1-N,4-N-dimethylpentane-1,4-diamine |
|---|---|
| PubChem CID | 63007950 |
| Molecular Formula | C11H26N2O |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.20 |
| IUPAC Name | 4-N-(3-methoxypropyl)-1-N,4-N-dimethylpentane-1,4-diamine |
| SMILES | CNCCCC(C)N(C)CCCOC |
| InChI | InChI=1S/C11H26N2O/c1-11(7-5-8-12-2)13(3)9-6-10-14-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | DAWZJLGOWABKMQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|