C20H42N4O3 — CID 58587436
4-[4-[4-[3-acetamidopropyl(methyl)amino]butyl-methylamino]butyl-methylamino]butanoic acid (PubChem CID 58587436) has the molecular formula C20H42N4O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is 4-[4-[4-[3-acetamidopropyl(methyl)amino]butyl-methylamino]butyl-methylamino]butanoic acid.
| Compound Name | 4-[4-[4-[3-acetamidopropyl(methyl)amino]butyl-methylamino]butyl-methylamino]butanoic acid |
|---|---|
| PubChem CID | 58587436 |
| Molecular Formula | C20H42N4O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.33 |
| IUPAC Name | 4-[4-[4-[3-acetamidopropyl(methyl)amino]butyl-methylamino]butyl-methylamino]butanoic acid |
| SMILES | CC(=O)NCCCN(C)CCCCN(C)CCCCN(C)CCCC(=O)O |
| InChI | InChI=1S/C20H42N4O3/c1-19(25)21-12-10-18-24(4)16-8-6-14-22(2)13-5-7-15-23(3)17-9-11-20(26)27/h5-18H2,1-4H3,(H,21,25)(H,26,27) |
| InChIKey | RALZIGZMQXQDAW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|