C21H47BN6O3 — CID 58587439
N-[4-[4-[4-[3-acetamidopropyl(methyl)amino]butyl-methylamino]butyl-methylamino]butanoylamino]-methylboronamidic acid (PubChem CID 58587439) has the molecular formula C21H47BN6O3 and a molecular weight of 442.46 g/mol. Its IUPAC name is N-[4-[4-[4-[3-acetamidopropyl(methyl)amino]butyl-methylamino]butyl-methylamino]butanoylamino]-methylboronamidic acid.
| Compound Name | N-[4-[4-[4-[3-acetamidopropyl(methyl)amino]butyl-methylamino]butyl-methylamino]butanoylamino]-methylboronamidic acid |
|---|---|
| PubChem CID | 58587439 |
| Molecular Formula | C21H47BN6O3 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | N-[4-[4-[4-[3-acetamidopropyl(methyl)amino]butyl-methylamino]butyl-methylamino]butanoylamino]-methylboronamidic acid |
| SMILES | CB(O)NNC(=O)CCCN(C)CCCCN(C)CCCCN(C)CCCNC(C)=O |
| InChI | InChI=1S/C21H47BN6O3/c1-20(29)23-13-11-19-28(5)17-9-7-15-26(3)14-6-8-16-27(4)18-10-12-21(30)24-25-22(2)31/h25,31H,6-19H2,1-5H3,(H,23,29)(H,24,30) |
| InChIKey | DPVGYIZOXVCKIJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|