C10H20N2O — CID 175286985
N,N-dimethylpent-1-en-1-amine;prop-2-enamide (PubChem CID 175286985) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N,N-dimethylpent-1-en-1-amine;prop-2-enamide.
| Compound Name | N,N-dimethylpent-1-en-1-amine;prop-2-enamide |
|---|---|
| PubChem CID | 175286985 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N,N-dimethylpent-1-en-1-amine;prop-2-enamide |
| SMILES | C=CC(N)=O.CCCC=CN(C)C |
| InChI | InChI=1S/C7H15N.C3H5NO/c1-4-5-6-7-8(2)3;1-2-3(4)5/h6-7H,4-5H2,1-3H3;2H,1H2,(H2,4,5) |
| InChIKey | RPLAKJWYKIMCOK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|