About CID 161294339
CID 161294339 (PubChem CID 161294339) has the molecular formula C6H12NO2Si
and a molecular weight of 158.25 g/mol.
Molecular Properties
| Compound Name | CID 161294339 |
| PubChem CID | 161294339 |
| Molecular Formula | C6H12NO2Si |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | — |
| SMILES | C=CC(N)=O.CCC[Si]=O |
| InChI | InChI=1S/C3H5NO.C3H7OSi/c1-2-3(4)5;1-2-3-5-4/h2H,1H2,(H2,4,5);2-3H2,1H3 |
| InChIKey | VGTUZQGWDABDLC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 161294339 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161294339?
The IUPAC name of CID 161294339 (CID 161294339) is not available.
What is the SMILES notation for CID 161294339?
The canonical SMILES for CID 161294339 is C=CC(N)=O.CCC[Si]=O.
What is the InChIKey of CID 161294339?
The InChIKey is VGTUZQGWDABDLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO.C3H7OSi/c1-2-3(4)5;1-2-3-5-4/h2H,1H2,(H2,4,5);2-3H2,1H3.
What are the key properties of CID 161294339?
CID 161294339 has a molecular weight of 158.25 g/mol, XLogP of 0.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161294339 is sourced from PubChem (CID 161294339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).