About ethenylphosphonic acid;prop-2-enamide
ethenylphosphonic acid;prop-2-enamide (PubChem CID 18401329) has the molecular formula C5H10NO4P
and a molecular weight of 179.11 g/mol. Its IUPAC name is ethenylphosphonic acid;prop-2-enamide.
Molecular Properties
| Compound Name | ethenylphosphonic acid;prop-2-enamide |
| PubChem CID | 18401329 |
| Molecular Formula | C5H10NO4P |
| Molecular Weight | 179.11 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | ethenylphosphonic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.C=CP(=O)(O)O |
| InChI | InChI=1S/C3H5NO.C2H5O3P/c1-2-3(4)5;1-2-6(3,4)5/h2H,1H2,(H2,4,5);2H,1H2,(H2,3,4,5) |
| InChIKey | KZZWSGLYJQRFAJ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.11 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethenylphosphonic acid;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylphosphonic acid;prop-2-enamide?
The IUPAC name of ethenylphosphonic acid;prop-2-enamide (CID 18401329) is ethenylphosphonic acid;prop-2-enamide.
What is the SMILES notation for ethenylphosphonic acid;prop-2-enamide?
The canonical SMILES for ethenylphosphonic acid;prop-2-enamide is C=CC(N)=O.C=CP(=O)(O)O.
What is the InChIKey of ethenylphosphonic acid;prop-2-enamide?
The InChIKey is KZZWSGLYJQRFAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO.C2H5O3P/c1-2-3(4)5;1-2-6(3,4)5/h2H,1H2,(H2,4,5);2H,1H2,(H2,3,4,5).
What are the key properties of ethenylphosphonic acid;prop-2-enamide?
ethenylphosphonic acid;prop-2-enamide has a molecular weight of 179.11 g/mol, XLogP of -0.03, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylphosphonic acid;prop-2-enamide is sourced from PubChem (CID 18401329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).