C3H9NO8P2 — CID 174924052
phosphono dihydrogen phosphate;prop-2-enamide (PubChem CID 174924052) has the molecular formula C3H9NO8P2 and a molecular weight of 249.05 g/mol. Its IUPAC name is phosphono dihydrogen phosphate;prop-2-enamide.
| Compound Name | phosphono dihydrogen phosphate;prop-2-enamide |
|---|---|
| PubChem CID | 174924052 |
| Molecular Formula | C3H9NO8P2 |
| Molecular Weight | 249.05 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | phosphono dihydrogen phosphate;prop-2-enamide |
| SMILES | C=CC(N)=O.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C3H5NO.H4O7P2/c1-2-3(4)5;1-8(2,3)7-9(4,5)6/h2H,1H2,(H2,4,5);(H2,1,2,3)(H2,4,5,6) |
| InChIKey | CYHYJDYFPOMWOY-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.05 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|