About trimagnesium;prop-2-enamide;diphosphate
trimagnesium;prop-2-enamide;diphosphate (PubChem CID 175566813) has the molecular formula C3H5Mg3NO9P2
and a molecular weight of 333.93 g/mol. Its IUPAC name is trimagnesium;prop-2-enamide;diphosphate.
Molecular Properties
| Compound Name | trimagnesium;prop-2-enamide;diphosphate |
| PubChem CID | 175566813 |
| Molecular Formula | C3H5Mg3NO9P2 |
| Molecular Weight | 333.93 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | trimagnesium;prop-2-enamide;diphosphate |
| SMILES | C=CC(N)=O.O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Mg+2].[Mg+2].[Mg+2] |
| InChI | InChI=1S/C3H5NO.3Mg.2H3O4P/c1-2-3(4)5;;;;2*1-5(2,3)4/h2H,1H2,(H2,4,5);;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6 |
| InChIKey | BOXYJBSXWYTERU-UHFFFAOYSA-H |
| XLogP | -7.13 |
| TPSA | 215.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.93 |
| LogP ≤ 5 | -7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze trimagnesium;prop-2-enamide;diphosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimagnesium;prop-2-enamide;diphosphate?
The IUPAC name of trimagnesium;prop-2-enamide;diphosphate (CID 175566813) is trimagnesium;prop-2-enamide;diphosphate.
What is the SMILES notation for trimagnesium;prop-2-enamide;diphosphate?
The canonical SMILES for trimagnesium;prop-2-enamide;diphosphate is C=CC(N)=O.O=P([O-])([O-])[O-].O=P([O-])([O-])[O-].[Mg+2].[Mg+2].[Mg+2].
What is the InChIKey of trimagnesium;prop-2-enamide;diphosphate?
The InChIKey is BOXYJBSXWYTERU-UHFFFAOYSA-H. The full InChI is InChI=1S/C3H5NO.3Mg.2H3O4P/c1-2-3(4)5;;;;2*1-5(2,3)4/h2H,1H2,(H2,4,5);;;;2*(H3,1,2,3,4)/q;3*+2;;/p-6.
What are the key properties of trimagnesium;prop-2-enamide;diphosphate?
trimagnesium;prop-2-enamide;diphosphate has a molecular weight of 333.93 g/mol, XLogP of -7.13, 1 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for trimagnesium;prop-2-enamide;diphosphate is sourced from PubChem (CID 175566813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).