C14H30N3O2+ — CID 7349371
10-[[(2E)-2-hydroxyiminoacetyl]amino]decyl-dimethylazanium (PubChem CID 7349371) has the molecular formula C14H30N3O2+ and a molecular weight of 272.41 g/mol. Its IUPAC name is 10-[[(2E)-2-hydroxyiminoacetyl]amino]decyl-dimethylazanium.
| Compound Name | 10-[[(2E)-2-hydroxyiminoacetyl]amino]decyl-dimethylazanium |
|---|---|
| PubChem CID | 7349371 |
| Molecular Formula | C14H30N3O2+ |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 10-[[(2E)-2-hydroxyiminoacetyl]amino]decyl-dimethylazanium |
| SMILES | C[NH+](C)CCCCCCCCCCNC(=O)/C=N/O |
| InChI | InChI=1S/C14H29N3O2/c1-17(2)12-10-8-6-4-3-5-7-9-11-15-14(18)13-16-19/h13,19H,3-12H2,1-2H3,(H,15,18)/p+1/b16-13+ |
| InChIKey | OJFDTOXIHKVGRT-DTQAZKPQSA-O |
| XLogP | 0.83 |
| TPSA | 66.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|