About N-phenyloctanethioamide
N-phenyloctanethioamide (PubChem CID 3767527) has the molecular formula C14H21NS
and a molecular weight of 235.40 g/mol. Its IUPAC name is N-phenyloctanethioamide.
Molecular Properties
| Compound Name | N-phenyloctanethioamide |
| PubChem CID | 3767527 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-phenyloctanethioamide |
| SMILES | CCCCCCCC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C14H21NS/c1-2-3-4-5-9-12-14(16)15-13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3,(H,15,16) |
| InChIKey | IKJBDOUBKSPDKV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-phenyloctanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyloctanethioamide?
The IUPAC name of N-phenyloctanethioamide (CID 3767527) is N-phenyloctanethioamide.
What is the SMILES notation for N-phenyloctanethioamide?
The canonical SMILES for N-phenyloctanethioamide is CCCCCCCC(=S)Nc1ccccc1.
What is the InChIKey of N-phenyloctanethioamide?
The InChIKey is IKJBDOUBKSPDKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NS/c1-2-3-4-5-9-12-14(16)15-13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3,(H,15,16).
What are the key properties of N-phenyloctanethioamide?
N-phenyloctanethioamide has a molecular weight of 235.40 g/mol, XLogP of 4.79, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyloctanethioamide is sourced from PubChem (CID 3767527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).