C12H10Cl2F13NO — CID 22167598
N-butyl-2,2-dichloro-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanamide (PubChem CID 22167598) has the molecular formula C12H10Cl2F13NO and a molecular weight of 502.10 g/mol. Its IUPAC name is N-butyl-2,2-dichloro-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanamide.
| Compound Name | N-butyl-2,2-dichloro-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanamide |
|---|---|
| PubChem CID | 22167598 |
| Molecular Formula | C12H10Cl2F13NO |
| Molecular Weight | 502.10 g/mol |
| Exact Mass | 500.99 |
| IUPAC Name | N-butyl-2,2-dichloro-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctanamide |
| SMILES | CCCCNC(=O)C(Cl)(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H10Cl2F13NO/c1-2-3-4-28-5(29)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)27/h2-4H2,1H3,(H,28,29) |
| InChIKey | PVOXVTXUYGUEHE-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.10 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|