About 3-methyloctylcarbamic acid
3-methyloctylcarbamic acid (PubChem CID 176952231) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 3-methyloctylcarbamic acid.
Molecular Properties
| Compound Name | 3-methyloctylcarbamic acid |
| PubChem CID | 176952231 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 3-methyloctylcarbamic acid |
| SMILES | CCCCCC(C)CCNC(=O)O |
| InChI | InChI=1S/C10H21NO2/c1-3-4-5-6-9(2)7-8-11-10(12)13/h9,11H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | MEKZQQHOUMMAET-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methyloctylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyloctylcarbamic acid?
The IUPAC name of 3-methyloctylcarbamic acid (CID 176952231) is 3-methyloctylcarbamic acid.
What is the SMILES notation for 3-methyloctylcarbamic acid?
The canonical SMILES for 3-methyloctylcarbamic acid is CCCCCC(C)CCNC(=O)O.
What is the InChIKey of 3-methyloctylcarbamic acid?
The InChIKey is MEKZQQHOUMMAET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO2/c1-3-4-5-6-9(2)7-8-11-10(12)13/h9,11H,3-8H2,1-2H3,(H,12,13).
What are the key properties of 3-methyloctylcarbamic acid?
3-methyloctylcarbamic acid has a molecular weight of 187.28 g/mol, XLogP of 2.86, 7 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyloctylcarbamic acid is sourced from PubChem (CID 176952231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).