C38H43N3O15 — CID 101095133
dimethyl 5-[2-[[3-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethylcarbamoyl]-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methoxy]benzoyl]amino]ethoxy]benzene-1,3-dicarboxylate (PubChem CID 101095133) has the molecular formula C38H43N3O15 and a molecular weight of 781.77 g/mol. Its IUPAC name is dimethyl 5-[2-[[3-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethylcarbamoyl]-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methoxy]benzoyl]amino]ethoxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2-[[3-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethylcarbamoyl]-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methoxy]benzoyl]amino]ethoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101095133 |
| Molecular Formula | C38H43N3O15 |
| Molecular Weight | 781.77 g/mol |
| Exact Mass | 781.27 |
| IUPAC Name | dimethyl 5-[2-[[3-[2-[3,5-bis(methoxycarbonyl)phenoxy]ethylcarbamoyl]-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methoxy]benzoyl]amino]ethoxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OCCNC(=O)c2cc(OCNC(=O)OC(C)(C)C)cc(C(=O)NCCOc3cc(C(=O)OC)cc(C(=O)OC)c3)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C38H43N3O15/c1-38(2,3)56-37(48)41-21-55-30-15-22(31(42)39-8-10-53-28-17-24(33(44)49-4)13-25(18-28)34(45)50-5)12-23(16-30)32(43)40-9-11-54-29-19-26(35(46)51-6)14-27(20-29)36(47)52-7/h12-20H,8-11,21H2,1-7H3,(H,39,42)(H,40,43)(H,41,48) |
| InChIKey | KLUACQORKFQVND-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 229.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|