C23H38N6O2 — CID 166454206
tert-butyl N-[5-[2-amino-6-[(4-methylpiperazin-1-yl)methyl]benzimidazol-1-yl]pentyl]carbamate (PubChem CID 166454206) has the molecular formula C23H38N6O2 and a molecular weight of 430.60 g/mol. Its IUPAC name is tert-butyl N-[5-[2-amino-6-[(4-methylpiperazin-1-yl)methyl]benzimidazol-1-yl]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-amino-6-[(4-methylpiperazin-1-yl)methyl]benzimidazol-1-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 166454206 |
| Molecular Formula | C23H38N6O2 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.31 |
| IUPAC Name | tert-butyl N-[5-[2-amino-6-[(4-methylpiperazin-1-yl)methyl]benzimidazol-1-yl]pentyl]carbamate |
| SMILES | CN1CCN(Cc2ccc3nc(N)n(CCCCCNC(=O)OC(C)(C)C)c3c2)CC1 |
| InChI | InChI=1S/C23H38N6O2/c1-23(2,3)31-22(30)25-10-6-5-7-11-29-20-16-18(8-9-19(20)26-21(29)24)17-28-14-12-27(4)13-15-28/h8-9,16H,5-7,10-15,17H2,1-4H3,(H2,24,26)(H,25,30) |
| InChIKey | FEQKGRPHPQPTDK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|