C31H44N6O2 — CID 170778088
tert-butyl N-[6-[3-cyclopropyl-4-[7-(1-methylpiperidin-4-yl)quinoxalin-2-yl]pyrazol-1-yl]hexyl]carbamate (PubChem CID 170778088) has the molecular formula C31H44N6O2 and a molecular weight of 532.73 g/mol. Its IUPAC name is tert-butyl N-[6-[3-cyclopropyl-4-[7-(1-methylpiperidin-4-yl)quinoxalin-2-yl]pyrazol-1-yl]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[3-cyclopropyl-4-[7-(1-methylpiperidin-4-yl)quinoxalin-2-yl]pyrazol-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 170778088 |
| Molecular Formula | C31H44N6O2 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | tert-butyl N-[6-[3-cyclopropyl-4-[7-(1-methylpiperidin-4-yl)quinoxalin-2-yl]pyrazol-1-yl]hexyl]carbamate |
| SMILES | CN1CCC(c2ccc3ncc(-c4cn(CCCCCCNC(=O)OC(C)(C)C)nc4C4CC4)nc3c2)CC1 |
| InChI | InChI=1S/C31H44N6O2/c1-31(2,3)39-30(38)32-15-7-5-6-8-16-37-21-25(29(35-37)23-9-10-23)28-20-33-26-12-11-24(19-27(26)34-28)22-13-17-36(4)18-14-22/h11-12,19-23H,5-10,13-18H2,1-4H3,(H,32,38) |
| InChIKey | NCJUTZWNGDBQIH-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|