C19H25N3O3S — CID 122440703
S-[[7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoxalin-2-yl]methyl] ethanethioate (PubChem CID 122440703) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is S-[[7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoxalin-2-yl]methyl] ethanethioate.
| Compound Name | S-[[7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoxalin-2-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 122440703 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | S-[[7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoxalin-2-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCc1cnc2ccc(CCCNC(=O)OC(C)(C)C)cc2n1 |
| InChI | InChI=1S/C19H25N3O3S/c1-13(23)26-12-15-11-21-16-8-7-14(10-17(16)22-15)6-5-9-20-18(24)25-19(2,3)4/h7-8,10-11H,5-6,9,12H2,1-4H3,(H,20,24) |
| InChIKey | AVHSFDRKRVHKHX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|