C18H25N3O5S — CID 175060309
methyl [7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoxalin-2-yl]methanesulfonate (PubChem CID 175060309) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is methyl [7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoxalin-2-yl]methanesulfonate.
| Compound Name | methyl [7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoxalin-2-yl]methanesulfonate |
|---|---|
| PubChem CID | 175060309 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | methyl [7-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]quinoxalin-2-yl]methanesulfonate |
| SMILES | COS(=O)(=O)Cc1cnc2ccc(CCCNC(=O)OC(C)(C)C)cc2n1 |
| InChI | InChI=1S/C18H25N3O5S/c1-18(2,3)26-17(22)19-9-5-6-13-7-8-15-16(10-13)21-14(11-20-15)12-27(23,24)25-4/h7-8,10-11H,5-6,9,12H2,1-4H3,(H,19,22) |
| InChIKey | UFHJLROMPTWGCE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|