C16H24N4O3 — CID 166454289
tert-butyl N-[2-[2-(2-aminobenzimidazol-1-yl)ethoxy]ethyl]carbamate (PubChem CID 166454289) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-aminobenzimidazol-1-yl)ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-aminobenzimidazol-1-yl)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166454289 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | tert-butyl N-[2-[2-(2-aminobenzimidazol-1-yl)ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCn1c(N)nc2ccccc21 |
| InChI | InChI=1S/C16H24N4O3/c1-16(2,3)23-15(21)18-8-10-22-11-9-20-13-7-5-4-6-12(13)19-14(20)17/h4-7H,8-11H2,1-3H3,(H2,17,19)(H,18,21) |
| InChIKey | QEUSCKBPINRUDA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|