C16H21N3O4 — CID 134560810
3-ethyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzimidazole-5-carboxylic acid (PubChem CID 134560810) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-ethyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzimidazole-5-carboxylic acid.
| Compound Name | 3-ethyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 134560810 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 3-ethyl-2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzimidazole-5-carboxylic acid |
| SMILES | CCn1c(CNC(=O)OC(C)(C)C)nc2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C16H21N3O4/c1-5-19-12-8-10(14(20)21)6-7-11(12)18-13(19)9-17-15(22)23-16(2,3)4/h6-8H,5,9H2,1-4H3,(H,17,22)(H,20,21) |
| InChIKey | QTYKARQKRZZBGR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |