C20H29N3O4 — CID 174972659
tert-butyl N-[(7-ethyl-7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraen-8-yl)methyl]carbamate;tert-butyl formate (PubChem CID 174972659) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is tert-butyl N-[(7-ethyl-7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraen-8-yl)methyl]carbamate;tert-butyl formate.
| Compound Name | tert-butyl N-[(7-ethyl-7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraen-8-yl)methyl]carbamate;tert-butyl formate |
|---|---|
| PubChem CID | 174972659 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | tert-butyl N-[(7-ethyl-7,9-diazatricyclo[4.3.0.02,4]nona-1,3,5,8-tetraen-8-yl)methyl]carbamate;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.CCn1c(CNC(=O)OC(C)(C)C)nc2c3cc-3cc21 |
| InChI | InChI=1S/C15H19N3O2.C5H10O2/c1-5-18-11-7-9-6-10(9)13(11)17-12(18)8-16-14(19)20-15(2,3)4;1-5(2,3)7-4-6/h6-7H,5,8H2,1-4H3,(H,16,19);4H,1-3H3 |
| InChIKey | HSPJLNWEEZSDPS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|