C17H22F3N3O2 — CID 91107429
tert-butyl N-[2-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]ethyl]carbamate (PubChem CID 91107429) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is tert-butyl N-[2-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 91107429 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | tert-butyl N-[2-[1-ethyl-6-(trifluoromethyl)benzimidazol-2-yl]ethyl]carbamate |
| SMILES | CCn1c(CCNC(=O)OC(C)(C)C)nc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C17H22F3N3O2/c1-5-23-13-10-11(17(18,19)20)6-7-12(13)22-14(23)8-9-21-15(24)25-16(2,3)4/h6-7,10H,5,8-9H2,1-4H3,(H,21,24) |
| InChIKey | DVEHMPRYEWANOZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |