C18H24FN3O2 — CID 123697961
tert-butyl N-[2-[1-(cyclopropylmethyl)-6-fluorobenzimidazol-2-yl]ethyl]carbamate (PubChem CID 123697961) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(cyclopropylmethyl)-6-fluorobenzimidazol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(cyclopropylmethyl)-6-fluorobenzimidazol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 123697961 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | tert-butyl N-[2-[1-(cyclopropylmethyl)-6-fluorobenzimidazol-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1nc2ccc(F)cc2n1CC1CC1 |
| InChI | InChI=1S/C18H24FN3O2/c1-18(2,3)24-17(23)20-9-8-16-21-14-7-6-13(19)10-15(14)22(16)11-12-4-5-12/h6-7,10,12H,4-5,8-9,11H2,1-3H3,(H,20,23) |
| InChIKey | UIUAMCSCWUKYNC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |