C15H16Cl2FN3O — CID 56804714
2,2-dichloro-N-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 56804714) has the molecular formula C15H16Cl2FN3O and a molecular weight of 344.22 g/mol. Its IUPAC name is 2,2-dichloro-N-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 56804714 |
| Molecular Formula | C15H16Cl2FN3O |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2,2-dichloro-N-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | Cn1c(CCNC(=O)C2(C)CC2(Cl)Cl)nc2ccc(F)cc21 |
| InChI | InChI=1S/C15H16Cl2FN3O/c1-14(8-15(14,16)17)13(22)19-6-5-12-20-10-4-3-9(18)7-11(10)21(12)2/h3-4,7H,5-6,8H2,1-2H3,(H,19,22) |
| InChIKey | VBADEVONGTVNLP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|