C16H23FN4O — CID 119883594
(2S)-2-amino-N-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethyl]-4-methylpentanamide (PubChem CID 119883594) has the molecular formula C16H23FN4O and a molecular weight of 306.38 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethyl]-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 119883594 |
| Molecular Formula | C16H23FN4O |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2S)-2-amino-N-[2-(6-fluoro-1-methylbenzimidazol-2-yl)ethyl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NCCc1nc2ccc(F)cc2n1C |
| InChI | InChI=1S/C16H23FN4O/c1-10(2)8-12(18)16(22)19-7-6-15-20-13-5-4-11(17)9-14(13)21(15)3/h4-5,9-10,12H,6-8,18H2,1-3H3,(H,19,22)/t12-/m0/s1 |
| InChIKey | MRYCVEASQPJNAA-LBPRGKRZSA-N |
| XLogP | 1.74 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |