C20H28N4O2 — CID 166454293
tert-butyl N-[(5S)-5-(2-amino-7-ethynylbenzimidazol-1-yl)hexyl]carbamate (PubChem CID 166454293) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-(2-amino-7-ethynylbenzimidazol-1-yl)hexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-(2-amino-7-ethynylbenzimidazol-1-yl)hexyl]carbamate |
|---|---|
| PubChem CID | 166454293 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | tert-butyl N-[(5S)-5-(2-amino-7-ethynylbenzimidazol-1-yl)hexyl]carbamate |
| SMILES | C#Cc1cccc2nc(N)n([C@@H](C)CCCCNC(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C20H28N4O2/c1-6-15-11-9-12-16-17(15)24(18(21)23-16)14(2)10-7-8-13-22-19(25)26-20(3,4)5/h1,9,11-12,14H,7-8,10,13H2,2-5H3,(H2,21,23)(H,22,25)/t14-/m0/s1 |
| InChIKey | JGPGMTMVAVGPIN-AWEZNQCLSA-N |
| XLogP | 3.86 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|