C21H33N5O3 — CID 166454230
tert-butyl N-[5-[2-amino-7-(dimethylcarbamoyl)benzimidazol-1-yl]-4-methylpentyl]carbamate (PubChem CID 166454230) has the molecular formula C21H33N5O3 and a molecular weight of 403.53 g/mol. Its IUPAC name is tert-butyl N-[5-[2-amino-7-(dimethylcarbamoyl)benzimidazol-1-yl]-4-methylpentyl]carbamate.
| Compound Name | tert-butyl N-[5-[2-amino-7-(dimethylcarbamoyl)benzimidazol-1-yl]-4-methylpentyl]carbamate |
|---|---|
| PubChem CID | 166454230 |
| Molecular Formula | C21H33N5O3 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | tert-butyl N-[5-[2-amino-7-(dimethylcarbamoyl)benzimidazol-1-yl]-4-methylpentyl]carbamate |
| SMILES | CC(CCCNC(=O)OC(C)(C)C)Cn1c(N)nc2cccc(C(=O)N(C)C)c21 |
| InChI | InChI=1S/C21H33N5O3/c1-14(9-8-12-23-20(28)29-21(2,3)4)13-26-17-15(18(27)25(5)6)10-7-11-16(17)24-19(26)22/h7,10-11,14H,8-9,12-13H2,1-6H3,(H2,22,24)(H,23,28) |
| InChIKey | MUTPHJYUWOHBHS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|