C17H27N3O4 — CID 58878822
3-amino-4-[[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]benzoic acid (PubChem CID 58878822) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-amino-4-[[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]benzoic acid.
| Compound Name | 3-amino-4-[[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]benzoic acid |
|---|---|
| PubChem CID | 58878822 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 3-amino-4-[[3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]amino]benzoic acid |
| SMILES | CC(C)(CCNc1ccc(C(=O)O)cc1N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27N3O4/c1-16(2,3)24-15(23)20-17(4,5)8-9-19-13-7-6-11(14(21)22)10-12(13)18/h6-7,10,19H,8-9,18H2,1-5H3,(H,20,23)(H,21,22) |
| InChIKey | CEJYVPIWPXDBNJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|