C19H22N2O5 — CID 178148128
methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypyridine-2-carboxylate (PubChem CID 178148128) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypyridine-2-carboxylate.
| Compound Name | methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypyridine-2-carboxylate |
|---|---|
| PubChem CID | 178148128 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | methyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylmethoxypyridine-2-carboxylate |
| SMILES | COC(=O)c1ccc(OCc2ccccc2)c(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C19H22N2O5/c1-19(2,3)26-18(23)21-16-15(11-10-14(20-16)17(22)24-4)25-12-13-8-6-5-7-9-13/h5-11H,12H2,1-4H3,(H,20,21,23) |
| InChIKey | GVPFAGQPNZSAEW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |