C26H30N2O5 — CID 10765971
butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-8-phenylmethoxyquinoline-3-carboxylate (PubChem CID 10765971) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-8-phenylmethoxyquinoline-3-carboxylate.
| Compound Name | butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-8-phenylmethoxyquinoline-3-carboxylate |
|---|---|
| PubChem CID | 10765971 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-8-phenylmethoxyquinoline-3-carboxylate |
| SMILES | CCCCOC(=O)c1cnc2c(OCc3ccccc3)cc(NC(=O)OC(C)(C)C)cc2c1 |
| InChI | InChI=1S/C26H30N2O5/c1-5-6-12-31-24(29)20-13-19-14-21(28-25(30)33-26(2,3)4)15-22(23(19)27-16-20)32-17-18-10-8-7-9-11-18/h7-11,13-16H,5-6,12,17H2,1-4H3,(H,28,30) |
| InChIKey | CVHDBBKPRJRGBC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|