C17H23N5O6S — CID 27209741
N-[(2S)-1-hydroxypropan-2-yl]-2-[2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]sulfanyl-5-nitrobenzimidazol-1-yl]acetamide (PubChem CID 27209741) has the molecular formula C17H23N5O6S and a molecular weight of 425.47 g/mol. Its IUPAC name is N-[(2S)-1-hydroxypropan-2-yl]-2-[2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]sulfanyl-5-nitrobenzimidazol-1-yl]acetamide.
| Compound Name | N-[(2S)-1-hydroxypropan-2-yl]-2-[2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]sulfanyl-5-nitrobenzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 27209741 |
| Molecular Formula | C17H23N5O6S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[(2S)-1-hydroxypropan-2-yl]-2-[2-[2-[[(2R)-1-hydroxypropan-2-yl]amino]-2-oxoethyl]sulfanyl-5-nitrobenzimidazol-1-yl]acetamide |
| SMILES | C[C@H](CO)NC(=O)CSc1nc2cc([N+](=O)[O-])ccc2n1CC(=O)N[C@@H](C)CO |
| InChI | InChI=1S/C17H23N5O6S/c1-10(7-23)18-15(25)6-21-14-4-3-12(22(27)28)5-13(14)20-17(21)29-9-16(26)19-11(2)8-24/h3-5,10-11,23-24H,6-9H2,1-2H3,(H,18,25)(H,19,26)/t10-,11+/m0/s1 |
| InChIKey | WMQAUZBLCVGRRV-WDEREUQCSA-N |
| XLogP | 0.03 |
| TPSA | 159.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|