C20H21N5O5S — CID 4234683
2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-(propan-2-ylcarbamoyl)acetamide (PubChem CID 4234683) has the molecular formula C20H21N5O5S and a molecular weight of 443.49 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-(propan-2-ylcarbamoyl)acetamide.
| Compound Name | 2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-(propan-2-ylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 4234683 |
| Molecular Formula | C20H21N5O5S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-(propan-2-ylcarbamoyl)acetamide |
| SMILES | COc1ccccc1-n1c(SCC(=O)NC(=O)NC(C)C)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H21N5O5S/c1-12(2)21-19(27)23-18(26)11-31-20-22-14-10-13(25(28)29)8-9-15(14)24(20)16-6-4-5-7-17(16)30-3/h4-10,12H,11H2,1-3H3,(H2,21,23,26,27) |
| InChIKey | YVWJOKOLQSIHPE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|