C24H21N3O4S — CID 4544482
1-(2,5-dimethylphenyl)-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylethanone (PubChem CID 4544482) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylethanone.
| Compound Name | 1-(2,5-dimethylphenyl)-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylethanone |
|---|---|
| PubChem CID | 4544482 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylethanone |
| SMILES | COc1ccccc1-n1c(SCC(=O)c2cc(C)ccc2C)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C24H21N3O4S/c1-15-8-9-16(2)18(12-15)22(28)14-32-24-25-19-13-17(27(29)30)10-11-20(19)26(24)21-6-4-5-7-23(21)31-3/h4-13H,14H2,1-3H3 |
| InChIKey | JKHLQDRRRZITQO-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|