C23H17F3N4O4S — CID 5131633
2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 5131633) has the molecular formula C23H17F3N4O4S and a molecular weight of 502.47 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 5131633 |
| Molecular Formula | C23H17F3N4O4S |
| Molecular Weight | 502.47 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccccc1-n1c(SCC(=O)Nc2ccc(C(F)(F)F)cc2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C23H17F3N4O4S/c1-34-20-5-3-2-4-19(20)29-18-11-10-16(30(32)33)12-17(18)28-22(29)35-13-21(31)27-15-8-6-14(7-9-15)23(24,25)26/h2-12H,13H2,1H3,(H,27,31) |
| InChIKey | QMWFHJXGCHUDHX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|