C23H26N4O4S — CID 23799328
N-cyclohexyl-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-methylacetamide (PubChem CID 23799328) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is N-cyclohexyl-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-methylacetamide.
| Compound Name | N-cyclohexyl-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 23799328 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | N-cyclohexyl-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N-methylacetamide |
| SMILES | COc1ccccc1-n1c(SCC(=O)N(C)C2CCCCC2)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C23H26N4O4S/c1-25(16-8-4-3-5-9-16)22(28)15-32-23-24-18-14-17(27(29)30)12-13-19(18)26(23)20-10-6-7-11-21(20)31-2/h6-7,10-14,16H,3-5,8-9,15H2,1-2H3 |
| InChIKey | FZERIVMSLNLUTC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|