C24H30N4O4S — CID 5192645
2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N,N-bis(2-methylpropyl)acetamide (PubChem CID 5192645) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is 2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N,N-bis(2-methylpropyl)acetamide.
| Compound Name | 2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N,N-bis(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 5192645 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanyl-N,N-bis(2-methylpropyl)acetamide |
| SMILES | COc1ccccc1-n1c(SCC(=O)N(CC(C)C)CC(C)C)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C24H30N4O4S/c1-16(2)13-26(14-17(3)4)23(29)15-33-24-25-19-12-18(28(30)31)10-11-20(19)27(24)21-8-6-7-9-22(21)32-5/h6-12,16-17H,13-15H2,1-5H3 |
| InChIKey | SEOVSBRNKNUZAM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 90.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|