C22H16N6O4S — CID 5135666
3-[[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one (PubChem CID 5135666) has the molecular formula C22H16N6O4S and a molecular weight of 460.48 g/mol. Its IUPAC name is 3-[[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 5135666 |
| Molecular Formula | C22H16N6O4S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 3-[[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylmethyl]-1,2,3-benzotriazin-4-one |
| SMILES | COc1ccccc1-n1c(SCn2nnc3ccccc3c2=O)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C22H16N6O4S/c1-32-20-9-5-4-8-19(20)27-18-11-10-14(28(30)31)12-17(18)23-22(27)33-13-26-21(29)15-6-2-3-7-16(15)24-25-26/h2-12H,13H2,1H3 |
| InChIKey | FWFMKXWSACCRMG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 117.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|