C25H28N4O4S — CID 98415719
N-[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylacetamide (PubChem CID 98415719) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylacetamide.
| Compound Name | N-[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 98415719 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-[(1R)-1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[1-(2-methoxyphenyl)-5-nitrobenzimidazol-2-yl]sulfanylacetamide |
| SMILES | COc1ccccc1-n1c(SCC(=O)N[C@H](C)[C@H]2C[C@@H]3CC[C@@H]2C3)nc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C25H28N4O4S/c1-15(19-12-16-7-8-17(19)11-16)26-24(30)14-34-25-27-20-13-18(29(31)32)9-10-21(20)28(25)22-5-3-4-6-23(22)33-2/h3-6,9-10,13,15-17,19H,7-8,11-12,14H2,1-2H3,(H,26,30)/t15-,16-,17-,19-/m1/s1 |
| InChIKey | NNGCHWCWXIIXCX-YWTNHNAXSA-N |
| XLogP | 4.98 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|